Diferenças entre edições de "Dimetil-hidrazina assimétrica"

937 bytes adicionados ,  20h52min de 2 de maio de 2008
m
chembox
m (chembox)
{{em tradução}}
{{chembox new
| ImageFileL1 = N-N-Dimethylhydrazine.png
| ImageSizeL1 = 150px
| ImageFileR1 = 1,1-dimethylhydrazine-3D-balls.png
| ImageSizeR1 = 150px
| IUPACName = 1,1-Dimethylhydrazine
| OtherNames =
| Abbreviations = UDMH
| Section1 = {{Chembox Identifiers
| CASNo = 57-14-7
| SMILES = NN(C)C
| InChI=1/C2H8N2/c1-4(2)3/h3H2,1-2H3}}
| Section2 = {{Chembox Properties
| Formula = C<sub>2</sub>H<sub>8</sub>N<sub>2</sub>
| MolarMass = 60.1 g/mol
| MeltingPtC = -57
| BoilingPtC = 63
| Density = 0.793 g/cm<sup>3</sup>}}
| Section7 = {{Chembox Hazards
| ExternalMSDS = [http://www.ilo.org/public/english/protection/safework/cis/products/icsc/dtasht/_icsc01/icsc0147.pdf External MSDS]
| EUClass = Toxic ('''T'''), Flammable ('''F'''), Harmful for the environment ('''N''')
| RPhrases = 45-11-23/25-34-51/53
| SPhrases = 53-45-61}}
| Section8 = {{Chembox Other
| OtherCpds = [[Hydrazine]]; [[monomethylhydrazine]]}}
}}
 
'''Di[[metil]] hidrazina assimétrica'''.
Na língua inglesa, " '''U'''nsymetrical '''D'''i'''M'''ethil '''H'''idrazine". É um derivado de [[hidrazina]], mais estável que esta, usado como propelente de foguetes.
59 772

edições