Abrir menu principal

Alterações

1 113 bytes adicionados, 02h54min de 2 de fevereiro de 2010
m
Chembox
{{sem-fontes|data=Abril de 2008}}
 
{{chembox new
| verifiedrevid = 329003891
| ImageFile = Acetyl-CoA-2D.svg
| ImageSize = 320
| ImageFile2 = Acetyl-CoA-3D-balls.png
| ImageSize2 = 320
| IUPACName =
| OtherNames =
| Section1 = {{Chembox Identifiers
| InChIKey = ZSLZBFCDCINBPY-ZSJPKINUBJ
| InChI = 1/C23H38N7O17P3S/c1-12(31)51-7-6-25-14(32)4-5-26-21(35)18(34)23(2,3)9-44-50(41,42)47-49(39,40)43-8-13-17(46-48(36,37)38)16(33)22(45-13)30-11-29-15-19(24)27-10-28-20(15)30/h10-11,13,16-18,22,33-34H,4-9H2,1-3H3,(H,25,32)(H,26,35)(H,39,40)(H,41,42)(H2,24,27,28)(H2,36,37,38)/t13-,16-,17-,18+,22-/m1/s1
| CASNo = 72-89-9
| CASNo_Ref = {{cascite}}
| ChemSpiderID=392413
| PubChem = 444493
| SMILES = O=C(SCCNC(=O)CCNC(=O)[C@H](O)C(C)(C)COP(=O)(O)OP(=O)(O)OC[C@H]3O[C@@H](n2cnc1c(ncnc12)N)[C@H](O)[C@@H]3OP(=O)(O)O)C
| MeSHName = Acetyl+Coenzyme+A
}}
| Section2 = {{Chembox Properties
| Formula = C<sub>23</sub>H<sub>38</sub>N<sub>7</sub>O<sub>17</sub>P<sub>3</sub>S
| MolarMass = 809.57 g/mol
| Appearance =
| Density =
| MeltingPt =
| BoilingPt =
}}
| Section3 = {{Chembox Hazards
| Solubility =
| MainHazards =
| FlashPt =
| Autoignition =
}}
}}
 
[[Ficheiro:Acetyl-CoA-2D.png|thumb|300 px|Representação da molécula de acetil-CoA.]]
 
59 772

edições