Resveratrol: diferenças entre revisões
Conteúdo apagado Conteúdo adicionado
m Bot: Adicionando: hu:Resveratrol |
m Chembox (falta traduzir, falta categorizar, falta pegar refs da de-wiki, falta agregar Chembox Related) |
||
Linha 1:
{{revisar}}
{{chembox new
| Watchedfields = changed
| verifiedrevid = 307526113
| Name = Resveratrol
| ImageFile = resveratrol.svg
| ImageSize = 250px
| ImageName = Chemical structure of ''trans''-resveratrol
| ImageFile1 = Resveratrol3d.png
| ImageSize1 = 180px
| ImageName1 = Chemical structure of ''trans''-resveratrol
| OtherNames = ''trans''-3,5,4'-Trihydroxystilbene;<br />3,4',5-Stilbenetriol;<br />''trans''-Resveratrol;<br />(''E'')-5-(''p''-Hydroxystyryl)resorcinol (''E'')-5-(4-hydroxystyryl)benzene-1,3-diol
| Section1 = {{Chembox Identifiers
| CASNo_Ref = {{cascite}}
| CASNo = 501-36-0
| PubChem = 445154
| ChemSpiderID = 392875
| SMILES = Oc2ccc(C=Cc1cc(O)cc(O)c1)cc2
| InChI=1/C14H12O3/c15-<br />12-5-3-10(4-6-12)<br />1-2-11-7-13(16)9-<br />14(17)8-11/h1-9,15-<br />17H/b2-1+
}}
| Section2 = {{Chembox Properties
| C = 14
| H = 12
| O = 3
| ExactMass = 228.078644
| Appearance = white powder with<br /> slight yellow cast
| Solubility1 = 0.03 g/L
| Solvent1 = water
| Solubility2 = 16 g/L
| Solvent2 = Dimethyl sulfoxide{{!}}DMSO
| Solubility3 = 50 g/L
| Solvent3 = ethanol
}}
}}
[[Ficheiro:Resveratrol.pdb.gif|thumb|Resveratrol.]]
| |||