Adenosina: diferenças entre revisões
Conteúdo apagado Conteúdo adicionado
Montando chembox a partir da de-wiki |
m Chembox += wiki.en (falta trad, dados legais PT/BR, cat, enriquecer Chembox Related) |
||
Linha 2:
{{Portal-bioquímica}}
{{Info/Química
| fundo = fármaco
| OtherNames = *(2''R'',3''R'',4''R'',5''R'')-2-(6-Aminopurin-9-yl)- 5-(hydroxymethyl)oxolan-3,4-diol *Ado *6-Aminopurin-9β-D-ribofuranosid
| ImageFile1 = Adenosin.svg
| ImageFile2 = Adenosine_spacefilling.png
| Section1 = {{Chembox Identifiers
| CASNo = 58-61-7
Linha 11 ⟶ 13:
| ATCCode_prefix = C01
| ATCCode_suffix = EB10
| SMILES = n2c1c(ncnc1n(c2)[C@@H]3O[C@@H]([C@@H](O)[C@H]3O)CO)N
| InChI = 1/C10H13N5O4/c11-8-5-9(13-2-12-8)15(3-14-5)10-7(18)6(17)4(1-16)19-10/h2-4,6-7,10,16-18H,1H2,(H2,11,12,13)/t4-,6-,7-,10-/m1/s1
| InChIKey = OIRDTQYFTABQOQ-KQYNXXCUBX
| ChemSpiderID = 54923
}}
| Section2 = {{Chembox Properties
Linha 20 ⟶ 26:
<ref name=woc>Wissenschaft-Online-Lexika: [http://www.wissenschaft-online.de/abo/lexikon/chemie/141 ''Eintrag zu Adenosin im Lexikon der Chemie.''] Abgerufen am 7. Januar 2010</ref>
| SolubleOther = *gut löslich in heißem Wasser <ref name=woc/>
}}
| Section5 = {{Chembox Pharmacology
| AdminRoutes = IV or injection
| Bioavail = Rapidly cleared from circulation via cellular uptake
| Metabolism = Rapidly converted to inosine and adenosine monophosphate
| HalfLife = cleared plasma <30 seconds - half life <10 seconds
| ProteinBound = No
| Excretion = can leave cell intact or can be degraded to hypoxanthine, xanthine, and ultimately uric acid
| Legal_AU = Legal
| Legal_US = Rx-only
| Legal_UK = Legal
| PregCat = C
}}
| Section7 = {{Chembox Hazards
Linha 26 ⟶ 44:
| LD50 = >20 g·kg<sup>−1</sup>(Camundongo, oral) <ref name="Roth"/>
}}
| Section8 = {{Chembox Related
| OtherCpds = [[Adenina]]<br />[[Adenosina monofosfato]]
}}
}}
| |||