Diferenças entre edições de "Ácido pícrico"

98 bytes adicionados ,  23h56min de 28 de janeiro de 2012
m
Checkwiki + ajustes
m (r2.7.1) (Robô: A adicionar: io:Melinito)
m (Checkwiki + ajustes)
{{Info/Química
{{chembox new
| ImageFile = Pikrinsäure.svg
| ImageSize = 200px
| IUPACName = 2,4,6-trinitrofenol
| OtherNames =
| Section1 = {{Chembox Info/Química/Identifiers
| Abbreviations =
| CASNo = 88-89-1
| EINECS =
| PubChem =
| SMILES = O=[N+]([O-])c1cc(cc([N+]([O-])=O)c1O)[N+]([O-])=O
| InChI =
| RTECS =TJ7875000
| MeSHName =
| ChEBI =
| KEGG =
| ATCCode_prefix =
| ATCCode_suffix =
| ATC_Supplemental =}}
| Section2 = {{Chembox Properties
| Formula = C<sub>6</sub>H<sub>3</sub>N<sub>3</sub>O<sub>7</sub>
| MolarMass =229.10 g/mol
| Appearance = Sólido incolor a amarelo
| Density = 1.763 g/cm³, sólido
| MeltingPt = 122.5&nbsp;°C
| Melting_notes =
| BoilingPt = > 300&nbsp;°C
| Boiling_notes = Explode
| Solubility = 1.40 g/100 mL
| SolubleOther =
| Solvent =
| pKa = 0.38
| pKb =
}}
| Section6 = {{Chembox Explosive
| ShockSens =
| FrictionSens =
| ExplosiveV = 7,350 m/s at ρ 1.70
| REFactor =
}}
| Section7 = {{Chembox Hazards
| EUClass =
| EUIndex =
| MainHazards =
| NFPA-H = 3
| NFPA-F = 4
| NFPA-R = 4
| NFPA-O =
| RPhrases = {{R1}} {{R10}} {{R36}} {{R37}} {{R38}}
| SPhrases = {{S28}} {{S35}} {{S37}} {{S45}}
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| PEL =
}}
| Section8 = {{Chembox Related
| OtherCpds = [[TNT]] (um -CH<sub>3</sub> em vez do -OH)<br />[[4-Nitrofenol]]<br />[[Ácido estífnico]] (mais um ''-OH'')
}}
}}
O '''ácido pícrico''' é um [[composto]] altamente explosivo antigamente utilizado na fabricação de [[armamento]]s, principalmente na produção de [[granada (arma)|granadas]] mas também, na produção de fármacos contra queimaduras. Esse [[ácido]] reage com a [[creatinina]] do sangue (a reação produz um tom amarelado). Com isso pode se medir a quantidade de [[creatinina]] no sangue.
 
Também conhecido como trinitrofenol, sólido de cor amarela, altamente tóxico e de forte acidez, é sensível ao choque, explode a 300&nbsp;°C. Usos: na medicina; na indústria para tingimentos, baterias elétricas, ataque químico a amostras de metais para análise metalográfica.
 
Irritante para a pele, olhos e trato respiratório. A inalação pode causar danos aos pulmões. A exposição crônica pode causar danos hepáticos ou renais.
 
 
{{esboço-composto-orgânico}}
{{Portal3|Química}}
 
[[Categoria{{DEFAULTSORT:Ácidos|Picrico]]}}
[[Categoria:Nitroderivados|Acido picricoÁcidos]]
[[Categoria:FenóisNitroderivados|Acido picricoPicrico]]
[[Categoria:Fenóis|Acido Picrico]]
 
[[ar:حمض البكريك]]
718 366

edições