Diferenças entre edições de "Biperideno"

791 bytes adicionados ,  15h06min de 13 de maio de 2012
infobox copiada do artigo em ingles
m (r2.7.2+) (Robô: A modificar: fa:بی‌پریدن)
(infobox copiada do artigo em ingles)
{{Info/Droga |
| nome_IUPAC = (1''RS'',2''SR'',4''RS'')-1-(bicyclo[2.2.1]hept-5-en-2-yl)-1-phenyl-3-(piperidin- 1-yl)propan-1-ol
| imagem = Biperiden Stereoisomers.png
| largura = 200
| imagem2 = Biperiden-3D-sticks.png
| largura2 = 200
| número_CAS = 514-65-8
| suplemento_CAS =
| prefixo_ATC = N04
| sufixo_ATC = AA02
| PubChem = 2381
| DrugBank = DB00810
| fórmula_química =
| C=21 | H=29 | N=1 | O=1
| peso_molecular = 311.461 g/mol
| smiles = OC(c1ccccc1)(CCN2CCCCC2)C4C3\C=C/C(C3)C4
| sinonimos =
| biodisponibilidade = 33 ± 5% (oral)
| ligação_a_proteínas = 60%
| metabolismo = hidroxilação [[hepática]]
| meia_vida_de_eliminação = 18 to 24 hours
| excreção = [[renal]]
| vias_de_administração = Oral, [[intramuscular injection|IM]], [[intravenous therapy|IV]]
}}
O '''biperideno''' é um [[fármaco]] [[anticolinérgico]], muito utilizado como tratamento adjuvante de [[doença de Parkinson|doentes com Parkinson]].<ref>P.R.Vade-mécum 2006/2007</ref>
 
Utilizador anónimo