Catequina: diferenças entre revisões
Conteúdo apagado Conteúdo adicionado
m Chembox += wiki.en (falta pegar fontes da wiki.de), agregando valor (Chembox Related) |
|||
Linha 1:
{{Info/Química
| Verifiedfields = changed
| Watchedfields = changed
| verifiedrevid = 455522430
| Name = Catechin
| Reference=
| ImageFile = (+)-Catechin.png
| ImageSize = 200px
| ImageAlt = Chemical structure of (+)-Catechin
| ImageName = Chemical structure of (+)-Catechin
| IUPACName = (2''R'',3''S'')-2-(3,4-dihydroxyphenyl)-3,4-dihydro-2''H''-chromene-3,5,7-triol
| OtherNames = Cianidanol<br>Cyanidanol<br>(+)-catechin<br>D-Catechin<br>Catechinic acid<br>Catechuic acid<br>Cianidol<br>Dexcyanidanol<br>(2R,3S)-Catechin<br>2,3-trans-catechin<br> 3,3',4',5,7–flavanpentol
|Section1= {{Chembox Identifiers
| ChemSpiderID_Ref = {{chemspidercite|correct|chemspider}}
| ChemSpiderID = 8711
| ChEMBL_Ref = {{ebicite|changed|EBI}}
| ChEMBL = 251445
| InChI = 1/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m0/s1
| InChIKey = PFTAWBLQPZVEMU-DZGCQCFKBX
| StdInChI_Ref = {{stdinchicite|correct|chemspider}}
| StdInChI = 1S/C15H14O6/c16-8-4-11(18)9-6-13(20)15(21-14(9)5-8)7-1-2-10(17)12(19)3-7/h1-5,13,15-20H,6H2/t13-,15+/m0/s1
| StdInChIKey_Ref = {{stdinchicite|correct|chemspider}}
| StdInChIKey = PFTAWBLQPZVEMU-DZGCQCFKSA-N
| CASNo = 7295-85-4
| CASNo_Ref = {{cascite|changed|??}}
| CASNo_Comment = (±)
| CASNo1 = 154-23-4
| CASNo1_Ref = {{cascite|correct|}}
| CASNo1_Comment = (+)
| CASNo2 = 18829-70-4
| CASNo2_Ref = {{cascite|correct|}}
| CASNo2_Comment = (-)
| CASNo3 = 88191-48-4
| CASNo3_Ref = {{cascite|correct|}}
| CASNo3_Comment = (+), hydrate
| PubChem = 9064
| UNII_Ref = {{fdacite|correct|FDA}}
| UNII = 8R1V1STN48
| ChEBI_Ref = {{ebicite|correct|EBI}}
| ChEBI = 15600
| SMILES = Oc1ccc(cc1O)[C@H]3Oc2cc(O)cc(O)c2C[C@@H]3O
}}
|Section2= {{Chembox Properties
| C=15|H=14|O=6
| ExactMass = 290.079038
| Appearance = Colorless solid
| Density =
| MeltingPtCL = 175
| MeltingPtCL = 177
| BoilingPt =
| Solubility =
| LambdaMax = 276 nm
| SpecRotation = +14.0°
}}
|Section3= {{Chembox Hazards
| ExternalMSDS = [http://www.sciencelab.com/xMSDS-Catechin_Hydrate-9923337 sciencelab] [http://www.applichem.com/fileadmin/datenblaetter/A4325_GB.pdf AppliChem]
| EUClass =
| EUIndex =
| MainHazards = Mutagenic for mammalian somatic cells, mutagenic for bacteria and/or yeast
| NFPA-H =
| NFPA-F =
| NFPA-R =
| NFPA-O =
| RPhrases = {{R36/37/38}}
| SPhrases = {{S26}}-{{S36}}
| RSPhrases =
| FlashPt =
| Autoignition =
| ExploLimits =
| LD50 = (+)-catechin : 10,000 mg/kg in rat (RTECS)<br>10,000 mg/kg in mouse<br>3,890 mg/kg in rat (other source)
| SkinHazard =
| EyeHazard =
| InhalationHazard =
| IngestionHazard =
| GHSPPictograms
| GHSSignalWord =
| HPhrases =
| PPhrases =
| TLV =
| PEL =
}}
| Section5 = {{Chembox Pharmacology
| AdminRoutes = Oral
| Bioavail =
| Metabolism =
| HalfLife =
| ProteinBound =
| Excretion = Urines
| Legal_status =
| Legal_US =
| Legal_UK =
| Legal_AU =
| Legal_CA =
| PregCat =
| PregCat_AU =
| PregCat_US =
}}
}}
'''Catequina''' é um [[fitonutriente]] da família dos [[polifenóis]], e tem uma forte acção [[antioxidante]]. Está presente de forma natural em alguns alimentos. Inúmeros estudos demonstram que os polifenóis presentes na planta do [[chá verde]] (''Camellia sinensis'') apresentam propriedades que actuam de forma benéfica em algumas doenças como a [[diabetes mellitus]] tipo1, as [[cardiopatia]]s, as [[virose|infecções virais]], as [[inflamação|inflamações]] em [[doenças degenerativas]] ou mesmo o [[cancro]] e o [[envelhecimento]].<ref>HAN, D-W., et al. Effectsof green tea polyphenol on preservation of human saphenous vein. J. Biotechnol. V. 110, p.109-117, 2004.</ref>
|